C17H20ClN4O3S+ — CID 7507644
2-[(6-chloro-1,3-benzothiazol-2-yl)-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]amino]ethyl-dimethylazanium (PubChem CID 7507644) has the molecular formula C17H20ClN4O3S+ and a molecular weight of 395.89 g/mol. Its IUPAC name is 2-[(6-chloro-1,3-benzothiazol-2-yl)-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[(6-chloro-1,3-benzothiazol-2-yl)-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7507644 |
| Molecular Formula | C17H20ClN4O3S+ |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 2-[(6-chloro-1,3-benzothiazol-2-yl)-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]amino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCN(C(=O)CN1C(=O)CCC1=O)c1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C17H19ClN4O3S/c1-20(2)7-8-21(16(25)10-22-14(23)5-6-15(22)24)17-19-12-4-3-11(18)9-13(12)26-17/h3-4,9H,5-8,10H2,1-2H3/p+1 |
| InChIKey | OQSJGJHNYMYSEY-UHFFFAOYSA-O |
| XLogP | 0.58 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|