C20H27N4O4S+ — CID 7511268
2-[[2-(2,5-dioxopyrrolidin-1-yl)acetyl]-(6-methoxy-1,3-benzothiazol-2-yl)amino]ethyl-diethylazanium (PubChem CID 7511268) has the molecular formula C20H27N4O4S+ and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-[[2-(2,5-dioxopyrrolidin-1-yl)acetyl]-(6-methoxy-1,3-benzothiazol-2-yl)amino]ethyl-diethylazanium.
| Compound Name | 2-[[2-(2,5-dioxopyrrolidin-1-yl)acetyl]-(6-methoxy-1,3-benzothiazol-2-yl)amino]ethyl-diethylazanium |
|---|---|
| PubChem CID | 7511268 |
| Molecular Formula | C20H27N4O4S+ |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 2-[[2-(2,5-dioxopyrrolidin-1-yl)acetyl]-(6-methoxy-1,3-benzothiazol-2-yl)amino]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCN(C(=O)CN1C(=O)CCC1=O)c1nc2ccc(OC)cc2s1 |
| InChI | InChI=1S/C20H26N4O4S/c1-4-22(5-2)10-11-23(19(27)13-24-17(25)8-9-18(24)26)20-21-15-7-6-14(28-3)12-16(15)29-20/h6-7,12H,4-5,8-11,13H2,1-3H3/p+1 |
| InChIKey | QVWVNDSJXJXUFI-UHFFFAOYSA-O |
| XLogP | 0.71 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|