C24H32O7 — CID 75080127
[9-acetyloxy-4-(2-hydroxy-4-methylpent-3-enylidene)-11-methylidene-3-oxo-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-7-yl]methyl acetate (PubChem CID 75080127) has the molecular formula C24H32O7 and a molecular weight of 432.51 g/mol. Its IUPAC name is [9-acetyloxy-4-(2-hydroxy-4-methylpent-3-enylidene)-11-methylidene-3-oxo-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-7-yl]methyl acetate.
| Compound Name | [9-acetyloxy-4-(2-hydroxy-4-methylpent-3-enylidene)-11-methylidene-3-oxo-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-7-yl]methyl acetate |
|---|---|
| PubChem CID | 75080127 |
| Molecular Formula | C24H32O7 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | [9-acetyloxy-4-(2-hydroxy-4-methylpent-3-enylidene)-11-methylidene-3-oxo-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-7-yl]methyl acetate |
| SMILES | C=C1CC(OC(C)=O)C=C(COC(C)=O)CCC2C(=CC(O)C=C(C)C)C(=O)OCC12 |
| InChI | InChI=1S/C24H32O7/c1-14(2)8-19(27)11-22-21-7-6-18(12-29-16(4)25)10-20(31-17(5)26)9-15(3)23(21)13-30-24(22)28/h8,10-11,19-21,23,27H,3,6-7,9,12-13H2,1-2,4-5H3 |
| InChIKey | OWMJGDBFOXYTMY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|