C22H28O9 — CID 162973888
[10-(acetyloxymethyl)-7-hydroxy-3,6-dimethylidene-2-oxo-4,5,7,8,9,11a-hexahydro-3aH-cyclodeca[b]furan-4-yl] 3,4-dihydroxy-2-methylidenebutanoate (PubChem CID 162973888) has the molecular formula C22H28O9 and a molecular weight of 436.46 g/mol. Its IUPAC name is [10-(acetyloxymethyl)-7-hydroxy-3,6-dimethylidene-2-oxo-4,5,7,8,9,11a-hexahydro-3aH-cyclodeca[b]furan-4-yl] 3,4-dihydroxy-2-methylidenebutanoate.
| Compound Name | [10-(acetyloxymethyl)-7-hydroxy-3,6-dimethylidene-2-oxo-4,5,7,8,9,11a-hexahydro-3aH-cyclodeca[b]furan-4-yl] 3,4-dihydroxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 162973888 |
| Molecular Formula | C22H28O9 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | [10-(acetyloxymethyl)-7-hydroxy-3,6-dimethylidene-2-oxo-4,5,7,8,9,11a-hexahydro-3aH-cyclodeca[b]furan-4-yl] 3,4-dihydroxy-2-methylidenebutanoate |
| SMILES | C=C1CC(OC(=O)C(=C)C(O)CO)C2C(=C)C(=O)OC2C=C(COC(C)=O)CCC1O |
| InChI | InChI=1S/C22H28O9/c1-11-7-18(30-21(27)12(2)17(26)9-23)20-13(3)22(28)31-19(20)8-15(5-6-16(11)25)10-29-14(4)24/h8,16-20,23,25-26H,1-3,5-7,9-10H2,4H3 |
| InChIKey | XTKAUQABQDSSRP-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|