C6H4N4O — CID 75088779
8aH-pyrido[4,3-e][1,2,4]triazin-8-one (PubChem CID 75088779) has the molecular formula C6H4N4O and a molecular weight of 148.12 g/mol. Its IUPAC name is 8aH-pyrido[4,3-e][1,2,4]triazin-8-one.
| Compound Name | 8aH-pyrido[4,3-e][1,2,4]triazin-8-one |
|---|---|
| PubChem CID | 75088779 |
| Molecular Formula | C6H4N4O |
| Molecular Weight | 148.12 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | 8aH-pyrido[4,3-e][1,2,4]triazin-8-one |
| SMILES | O=C1N=CC=C2N=CN=NC12 |
| InChI | InChI=1S/C6H4N4O/c11-6-5-4(1-2-7-6)8-3-9-10-5/h1-3,5H |
| InChIKey | RLLDLYDYDNRLFI-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 66.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.12 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |