C41H64N4O8 — CID 75091441
3-benzyl-6-butan-2-yl-7,12,17-trimethyl-13-pentyl-9,16-di(propan-2-yl)-4,14-dioxa-1,7,10,17-tetrazabicyclo[17.3.0]docosane-2,5,8,11,15,18-hexone (PubChem CID 75091441) has the molecular formula C41H64N4O8 and a molecular weight of 740.98 g/mol. Its IUPAC name is 3-benzyl-6-butan-2-yl-7,12,17-trimethyl-13-pentyl-9,16-di(propan-2-yl)-4,14-dioxa-1,7,10,17-tetrazabicyclo[17.3.0]docosane-2,5,8,11,15,18-hexone.
| Compound Name | 3-benzyl-6-butan-2-yl-7,12,17-trimethyl-13-pentyl-9,16-di(propan-2-yl)-4,14-dioxa-1,7,10,17-tetrazabicyclo[17.3.0]docosane-2,5,8,11,15,18-hexone |
|---|---|
| PubChem CID | 75091441 |
| Molecular Formula | C41H64N4O8 |
| Molecular Weight | 740.98 g/mol |
| Exact Mass | 740.47 |
| IUPAC Name | 3-benzyl-6-butan-2-yl-7,12,17-trimethyl-13-pentyl-9,16-di(propan-2-yl)-4,14-dioxa-1,7,10,17-tetrazabicyclo[17.3.0]docosane-2,5,8,11,15,18-hexone |
| SMILES | CCCCCC1OC(=O)C(C(C)C)N(C)C(=O)C2CCCN2C(=O)C(Cc2ccccc2)OC(=O)C(C(C)CC)N(C)C(=O)C(C(C)C)NC(=O)C1C |
| InChI | InChI=1S/C41H64N4O8/c1-11-13-15-22-31-28(8)36(46)42-33(25(3)4)39(49)44(10)35(27(7)12-2)41(51)53-32(24-29-19-16-14-17-20-29)38(48)45-23-18-21-30(45)37(47)43(9)34(26(5)6)40(50)52-31/h14,16-17,19-20,25-28,30-35H,11-13,15,18,21-24H2,1-10H3,(H,42,46) |
| InChIKey | CQEZMRWKVFFGKE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 142.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.98 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|