C36H62N4O8 — CID 164512231
(6R,9R,12R,13S,16R,19R)-7,12,17-trimethyl-13-pentyl-3,6,9,16-tetra(propan-2-yl)-4,14-dioxa-1,7,10,17-tetrazabicyclo[17.3.0]docosane-2,5,8,11,15,18-hexone (PubChem CID 164512231) has the molecular formula C36H62N4O8 and a molecular weight of 678.91 g/mol. Its IUPAC name is (6R,9R,12R,13S,16R,19R)-7,12,17-trimethyl-13-pentyl-3,6,9,16-tetra(propan-2-yl)-4,14-dioxa-1,7,10,17-tetrazabicyclo[17.3.0]docosane-2,5,8,11,15,18-hexone.
| Compound Name | (6R,9R,12R,13S,16R,19R)-7,12,17-trimethyl-13-pentyl-3,6,9,16-tetra(propan-2-yl)-4,14-dioxa-1,7,10,17-tetrazabicyclo[17.3.0]docosane-2,5,8,11,15,18-hexone |
|---|---|
| PubChem CID | 164512231 |
| Molecular Formula | C36H62N4O8 |
| Molecular Weight | 678.91 g/mol |
| Exact Mass | 678.46 |
| IUPAC Name | (6R,9R,12R,13S,16R,19R)-7,12,17-trimethyl-13-pentyl-3,6,9,16-tetra(propan-2-yl)-4,14-dioxa-1,7,10,17-tetrazabicyclo[17.3.0]docosane-2,5,8,11,15,18-hexone |
| SMILES | CCCCC[C@@H]1OC(=O)[C@@H](C(C)C)N(C)C(=O)[C@H]2CCCN2C(=O)C(C(C)C)OC(=O)[C@@H](C(C)C)N(C)C(=O)[C@@H](C(C)C)NC(=O)[C@@H]1C |
| InChI | InChI=1S/C36H62N4O8/c1-13-14-15-18-26-24(10)31(41)37-27(20(2)3)33(43)39(12)29(22(6)7)36(46)48-30(23(8)9)34(44)40-19-16-17-25(40)32(42)38(11)28(21(4)5)35(45)47-26/h20-30H,13-19H2,1-12H3,(H,37,41)/t24-,25-,26+,27-,28-,29-,30?/m1/s1 |
| InChIKey | VJYQPLSJYQMFHT-GKFWMEGRSA-N |
| XLogP | 3.79 |
| TPSA | 142.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.91 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|