C20H26O7 — CID 75096976
8,18-dihydroxy-15,16-dimethoxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),12,15,17-tetraene-2,9-dione (PubChem CID 75096976) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is 8,18-dihydroxy-15,16-dimethoxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),12,15,17-tetraene-2,9-dione.
| Compound Name | 8,18-dihydroxy-15,16-dimethoxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),12,15,17-tetraene-2,9-dione |
|---|---|
| PubChem CID | 75096976 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 8,18-dihydroxy-15,16-dimethoxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),12,15,17-tetraene-2,9-dione |
| SMILES | COc1cc(O)c2c(c1OC)C=CCCC(=O)C(O)CCCC(C)OC2=O |
| InChI | InChI=1S/C20H26O7/c1-12-7-6-10-15(22)14(21)9-5-4-8-13-18(20(24)27-12)16(23)11-17(25-2)19(13)26-3/h4,8,11-12,15,22-23H,5-7,9-10H2,1-3H3 |
| InChIKey | IXWZTCKQQIAFGC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |