C38H39N5O7S — CID 75097177
14-methyl-3,6,9,12,15-pentaoxo-11-[(4-phenylphenyl)methyl]-8-(thiophen-2-ylmethyl)-2,7,10,13,16-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-17-carboxylic acid (PubChem CID 75097177) has the molecular formula C38H39N5O7S and a molecular weight of 709.83 g/mol. Its IUPAC name is 14-methyl-3,6,9,12,15-pentaoxo-11-[(4-phenylphenyl)methyl]-8-(thiophen-2-ylmethyl)-2,7,10,13,16-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-17-carboxylic acid.
| Compound Name | 14-methyl-3,6,9,12,15-pentaoxo-11-[(4-phenylphenyl)methyl]-8-(thiophen-2-ylmethyl)-2,7,10,13,16-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-17-carboxylic acid |
|---|---|
| PubChem CID | 75097177 |
| Molecular Formula | C38H39N5O7S |
| Molecular Weight | 709.83 g/mol |
| Exact Mass | 709.26 |
| IUPAC Name | 14-methyl-3,6,9,12,15-pentaoxo-11-[(4-phenylphenyl)methyl]-8-(thiophen-2-ylmethyl)-2,7,10,13,16-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-17-carboxylic acid |
| SMILES | CC1NC(=O)C(Cc2ccc(-c3ccccc3)cc2)NC(=O)C(Cc2cccs2)NC(=O)CCC(=O)Nc2ccc(cc2)CC(C(=O)O)NC1=O |
| InChI | InChI=1S/C38H39N5O7S/c1-23-35(46)43-32(38(49)50)21-25-11-15-28(16-12-25)40-33(44)17-18-34(45)41-31(22-29-8-5-19-51-29)37(48)42-30(36(47)39-23)20-24-9-13-27(14-10-24)26-6-3-2-4-7-26/h2-16,19,23,30-32H,17-18,20-22H2,1H3,(H,39,47)(H,40,44)(H,41,45)(H,42,48)(H,43,46)(H,49,50) |
| InChIKey | RFYVZEYDMRLBST-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 182.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.83 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|