C44H43N5O7S — CID 75097184
13-benzyl-3,6,9,12,15-pentaoxo-11-[(4-phenylphenyl)methyl]-8-(thiophen-2-ylmethyl)-2,7,10,13,16-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-17-carboxylic acid (PubChem CID 75097184) has the molecular formula C44H43N5O7S and a molecular weight of 785.92 g/mol. Its IUPAC name is 13-benzyl-3,6,9,12,15-pentaoxo-11-[(4-phenylphenyl)methyl]-8-(thiophen-2-ylmethyl)-2,7,10,13,16-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-17-carboxylic acid.
| Compound Name | 13-benzyl-3,6,9,12,15-pentaoxo-11-[(4-phenylphenyl)methyl]-8-(thiophen-2-ylmethyl)-2,7,10,13,16-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-17-carboxylic acid |
|---|---|
| PubChem CID | 75097184 |
| Molecular Formula | C44H43N5O7S |
| Molecular Weight | 785.92 g/mol |
| Exact Mass | 785.29 |
| IUPAC Name | 13-benzyl-3,6,9,12,15-pentaoxo-11-[(4-phenylphenyl)methyl]-8-(thiophen-2-ylmethyl)-2,7,10,13,16-pentazabicyclo[17.2.2]tricosa-1(21),19,22-triene-17-carboxylic acid |
| SMILES | O=C1CCC(=O)NC(Cc2cccs2)C(=O)NC(Cc2ccc(-c3ccccc3)cc2)C(=O)N(Cc2ccccc2)CC(=O)NC(C(=O)O)Cc2ccc(cc2)N1 |
| InChI | InChI=1S/C44H43N5O7S/c50-39-21-22-40(51)46-36(26-35-12-7-23-57-35)42(53)48-37(24-29-13-17-33(18-14-29)32-10-5-2-6-11-32)43(54)49(27-31-8-3-1-4-9-31)28-41(52)47-38(44(55)56)25-30-15-19-34(45-39)20-16-30/h1-20,23,36-38H,21-22,24-28H2,(H,45,50)(H,46,51)(H,47,52)(H,48,53)(H,55,56) |
| InChIKey | WBYUASGHJHLHES-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 174.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.92 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|