C31H38O9 — CID 75107162
[3,4,5,19-tetramethoxy-9,10-dimethyl-8-(2-methylbut-2-enoyl)-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-11-yl] propanoate (PubChem CID 75107162) has the molecular formula C31H38O9 and a molecular weight of 554.64 g/mol. Its IUPAC name is [3,4,5,19-tetramethoxy-9,10-dimethyl-8-(2-methylbut-2-enoyl)-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-11-yl] propanoate.
| Compound Name | [3,4,5,19-tetramethoxy-9,10-dimethyl-8-(2-methylbut-2-enoyl)-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-11-yl] propanoate |
|---|---|
| PubChem CID | 75107162 |
| Molecular Formula | C31H38O9 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | [3,4,5,19-tetramethoxy-9,10-dimethyl-8-(2-methylbut-2-enoyl)-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-11-yl] propanoate |
| SMILES | CC=C(C)C(=O)C1c2cc(OC)c(OC)c(OC)c2-c2c(cc3c(c2OC)OCO3)C(OC(=O)CC)C(C)C1C |
| InChI | InChI=1S/C31H38O9/c1-10-15(3)26(33)23-16(4)17(5)27(40-22(32)11-2)19-13-21-29(39-14-38-21)31(37-9)25(19)24-18(23)12-20(34-6)28(35-7)30(24)36-8/h10,12-13,16-17,23,27H,11,14H2,1-9H3 |
| InChIKey | IUKCHGGUYYPBRQ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|