C36H42O10 — CID 56664002
(8-benzoyl-9-hydroxy-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-11-yl) hexanoate (PubChem CID 56664002) has the molecular formula C36H42O10 and a molecular weight of 634.72 g/mol. Its IUPAC name is (8-benzoyl-9-hydroxy-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-11-yl) hexanoate.
| Compound Name | (8-benzoyl-9-hydroxy-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-11-yl) hexanoate |
|---|---|
| PubChem CID | 56664002 |
| Molecular Formula | C36H42O10 |
| Molecular Weight | 634.72 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | (8-benzoyl-9-hydroxy-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-11-yl) hexanoate |
| SMILES | CCCCCC(=O)OC1c2cc3c(c(OC)c2-c2c(cc(OC)c(OC)c2OC)C(C(=O)c2ccccc2)C(C)(O)C1C)OCO3 |
| InChI | InChI=1S/C36H42O10/c1-8-9-11-16-26(37)46-31-20(2)36(3,39)29(30(38)21-14-12-10-13-15-21)22-17-24(40-4)32(41-5)34(42-6)27(22)28-23(31)18-25-33(35(28)43-7)45-19-44-25/h10,12-15,17-18,20,29,31,39H,8-9,11,16,19H2,1-7H3 |
| InChIKey | UHZVOOFMWZABRC-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.72 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|