C23H24N3O3S+ — CID 7510838
2-[(4,6-dimethyl-1,3-benzothiazol-2-yl)-(2-oxochromene-3-carbonyl)amino]ethyl-dimethylazanium (PubChem CID 7510838) has the molecular formula C23H24N3O3S+ and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[(4,6-dimethyl-1,3-benzothiazol-2-yl)-(2-oxochromene-3-carbonyl)amino]ethyl-dimethylazanium.
| Compound Name | 2-[(4,6-dimethyl-1,3-benzothiazol-2-yl)-(2-oxochromene-3-carbonyl)amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7510838 |
| Molecular Formula | C23H24N3O3S+ |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-[(4,6-dimethyl-1,3-benzothiazol-2-yl)-(2-oxochromene-3-carbonyl)amino]ethyl-dimethylazanium |
| SMILES | Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3cc4ccccc4oc3=O)sc2c1 |
| InChI | InChI=1S/C23H23N3O3S/c1-14-11-15(2)20-19(12-14)30-23(24-20)26(10-9-25(3)4)21(27)17-13-16-7-5-6-8-18(16)29-22(17)28/h5-8,11-13H,9-10H2,1-4H3/p+1 |
| InChIKey | FGXSGWIQCSVONG-UHFFFAOYSA-O |
| XLogP | 2.81 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|