C29H42O9 — CID 75111198
[1,3-diacetyloxy-9,10-dihydroxy-7,8-dimethyl-7-(3-methylpenta-2,4-dienyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] 2-methylbutanoate (PubChem CID 75111198) has the molecular formula C29H42O9 and a molecular weight of 534.65 g/mol. Its IUPAC name is [1,3-diacetyloxy-9,10-dihydroxy-7,8-dimethyl-7-(3-methylpenta-2,4-dienyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] 2-methylbutanoate.
| Compound Name | [1,3-diacetyloxy-9,10-dihydroxy-7,8-dimethyl-7-(3-methylpenta-2,4-dienyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 75111198 |
| Molecular Formula | C29H42O9 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | [1,3-diacetyloxy-9,10-dihydroxy-7,8-dimethyl-7-(3-methylpenta-2,4-dienyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] 2-methylbutanoate |
| SMILES | C=CC(C)=CCC1(C)C(C)C(O)C(O)C23C(=CC(OC(=O)C(C)CC)CC12)C(OC(C)=O)OC3OC(C)=O |
| InChI | InChI=1S/C29H42O9/c1-9-15(3)11-12-28(8)17(5)23(32)24(33)29-21(26(35-18(6)30)38-27(29)36-19(7)31)13-20(14-22(28)29)37-25(34)16(4)10-2/h9,11,13,16-17,20,22-24,26-27,32-33H,1,10,12,14H2,2-8H3 |
| InChIKey | WJYKXMBOMMKQKV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|