C31H38O8 — CID 163193593
[(1R,3R,5S,6aR,7R,8S,10S,10aR)-1,3-diacetyloxy-10-hydroxy-7,8-dimethyl-7-[(2E)-3-methylpenta-2,4-dienyl]-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] benzoate (PubChem CID 163193593) has the molecular formula C31H38O8 and a molecular weight of 538.64 g/mol. Its IUPAC name is [(1R,3R,5S,6aR,7R,8S,10S,10aR)-1,3-diacetyloxy-10-hydroxy-7,8-dimethyl-7-[(2E)-3-methylpenta-2,4-dienyl]-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] benzoate.
| Compound Name | [(1R,3R,5S,6aR,7R,8S,10S,10aR)-1,3-diacetyloxy-10-hydroxy-7,8-dimethyl-7-[(2E)-3-methylpenta-2,4-dienyl]-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] benzoate |
|---|---|
| PubChem CID | 163193593 |
| Molecular Formula | C31H38O8 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | [(1R,3R,5S,6aR,7R,8S,10S,10aR)-1,3-diacetyloxy-10-hydroxy-7,8-dimethyl-7-[(2E)-3-methylpenta-2,4-dienyl]-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] benzoate |
| SMILES | C=C/C(C)=C/C[C@@]1(C)[C@H]2C[C@H](OC(=O)c3ccccc3)C=C3[C@@H](OC(C)=O)O[C@H](OC(C)=O)[C@@]32[C@@H](O)C[C@@H]1C |
| InChI | InChI=1S/C31H38O8/c1-7-18(2)13-14-30(6)19(3)15-26(34)31-24(28(36-20(4)32)39-29(31)37-21(5)33)16-23(17-25(30)31)38-27(35)22-11-9-8-10-12-22/h7-13,16,19,23,25-26,28-29,34H,1,14-15,17H2,2-6H3/b18-13+/t19-,23+,25+,26-,28-,29-,30+,31-/m0/s1 |
| InChIKey | VTZWGFLNNUDMPY-HACPLIHYSA-N |
| XLogP | 4.88 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|