C35H42O9 — CID 72732498
[1,3,5-triacetyloxy-7,8-dimethyl-7-(3-methylpenta-2,4-dienyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-10-yl] 3-phenylprop-2-enoate (PubChem CID 72732498) has the molecular formula C35H42O9 and a molecular weight of 606.71 g/mol. Its IUPAC name is [1,3,5-triacetyloxy-7,8-dimethyl-7-(3-methylpenta-2,4-dienyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-10-yl] 3-phenylprop-2-enoate.
| Compound Name | [1,3,5-triacetyloxy-7,8-dimethyl-7-(3-methylpenta-2,4-dienyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-10-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 72732498 |
| Molecular Formula | C35H42O9 |
| Molecular Weight | 606.71 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | [1,3,5-triacetyloxy-7,8-dimethyl-7-(3-methylpenta-2,4-dienyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-10-yl] 3-phenylprop-2-enoate |
| SMILES | C=CC(C)=CCC1(C)C(C)CC(OC(=O)C=Cc2ccccc2)C23C(=CC(OC(C)=O)CC12)C(OC(C)=O)OC3OC(C)=O |
| InChI | InChI=1S/C35H42O9/c1-8-21(2)16-17-34(7)22(3)18-30(43-31(39)15-14-26-12-10-9-11-13-26)35-28(19-27(20-29(34)35)40-23(4)36)32(41-24(5)37)44-33(35)42-25(6)38/h8-16,19,22,27,29-30,32-33H,1,17-18,20H2,2-7H3 |
| InChIKey | NCMOHDQDZGQJRD-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.71 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|