C20H36N4O3 — CID 75111317
2-[1-(cyclohexylcarbamoyl)-3-(2-piperazin-1-ylethyl)piperidin-4-yl]acetic acid (PubChem CID 75111317) has the molecular formula C20H36N4O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is 2-[1-(cyclohexylcarbamoyl)-3-(2-piperazin-1-ylethyl)piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-(cyclohexylcarbamoyl)-3-(2-piperazin-1-ylethyl)piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 75111317 |
| Molecular Formula | C20H36N4O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | 2-[1-(cyclohexylcarbamoyl)-3-(2-piperazin-1-ylethyl)piperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1CCN(C(=O)NC2CCCCC2)CC1CCN1CCNCC1 |
| InChI | InChI=1S/C20H36N4O3/c25-19(26)14-16-7-11-24(20(27)22-18-4-2-1-3-5-18)15-17(16)6-10-23-12-8-21-9-13-23/h16-18,21H,1-15H2,(H,22,27)(H,25,26) |
| InChIKey | AHLPMYBNSUSICD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |