C12H20N4O5 — CID 75113594
2-[[3-amino-2-[(4-amino-4-oxobut-2-enoyl)amino]propanoyl]amino]-3-methylbutanoic acid (PubChem CID 75113594) has the molecular formula C12H20N4O5 and a molecular weight of 300.32 g/mol. Its IUPAC name is 2-[[3-amino-2-[(4-amino-4-oxobut-2-enoyl)amino]propanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[3-amino-2-[(4-amino-4-oxobut-2-enoyl)amino]propanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 75113594 |
| Molecular Formula | C12H20N4O5 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-[[3-amino-2-[(4-amino-4-oxobut-2-enoyl)amino]propanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)C(CN)NC(=O)C=CC(N)=O)C(=O)O |
| InChI | InChI=1S/C12H20N4O5/c1-6(2)10(12(20)21)16-11(19)7(5-13)15-9(18)4-3-8(14)17/h3-4,6-7,10H,5,13H2,1-2H3,(H2,14,17)(H,15,18)(H,16,19)(H,20,21) |
| InChIKey | IRWJJINNIZZEIB-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|