C12H14O2S — CID 751182
(1S,4R)-4-cyclopropyl-1-thiophen-2-ylpent-2-yne-1,4-diol (PubChem CID 751182) has the molecular formula C12H14O2S and a molecular weight of 222.31 g/mol. Its IUPAC name is (1S,4R)-4-cyclopropyl-1-thiophen-2-ylpent-2-yne-1,4-diol.
| Compound Name | (1S,4R)-4-cyclopropyl-1-thiophen-2-ylpent-2-yne-1,4-diol |
|---|---|
| PubChem CID | 751182 |
| Molecular Formula | C12H14O2S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | (1S,4R)-4-cyclopropyl-1-thiophen-2-ylpent-2-yne-1,4-diol |
| SMILES | C[C@](O)(C#C[C@H](O)c1cccs1)C1CC1 |
| InChI | InChI=1S/C12H14O2S/c1-12(14,9-4-5-9)7-6-10(13)11-3-2-8-15-11/h2-3,8-10,13-14H,4-5H2,1H3/t10-,12-/m0/s1 |
| InChIKey | MFICLTOGKFDEHB-JQWIXIFHSA-N |
| XLogP | 1.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|