C24H25ClN2O4 — CID 75126031
N-[1-(2-chlorophenyl)ethyl]-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enamide (PubChem CID 75126031) has the molecular formula C24H25ClN2O4 and a molecular weight of 440.93 g/mol. Its IUPAC name is N-[1-(2-chlorophenyl)ethyl]-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[1-(2-chlorophenyl)ethyl]-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 75126031 |
| Molecular Formula | C24H25ClN2O4 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-[1-(2-chlorophenyl)ethyl]-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)NC(C)c2ccccc2Cl)ccc1OCc1c(C)noc1C |
| InChI | InChI=1S/C24H25ClN2O4/c1-15(19-7-5-6-8-21(19)25)26-24(28)12-10-18-9-11-22(23(13-18)29-4)30-14-20-16(2)27-31-17(20)3/h5-13,15H,14H2,1-4H3,(H,26,28) |
| InChIKey | QBNDFFYVVZPHAJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|