C16H17N3OS2 — CID 7513021
5-methoxy-N-[(6R)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-1,3-benzothiazol-2-amine (PubChem CID 7513021) has the molecular formula C16H17N3OS2 and a molecular weight of 331.47 g/mol. Its IUPAC name is 5-methoxy-N-[(6R)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-1,3-benzothiazol-2-amine.
| Compound Name | 5-methoxy-N-[(6R)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 7513021 |
| Molecular Formula | C16H17N3OS2 |
| Molecular Weight | 331.47 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 5-methoxy-N-[(6R)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc2sc(Nc3nc4c(s3)C[C@H](C)CC4)nc2c1 |
| InChI | InChI=1S/C16H17N3OS2/c1-9-3-5-11-14(7-9)22-15(17-11)19-16-18-12-8-10(20-2)4-6-13(12)21-16/h4,6,8-9H,3,5,7H2,1-2H3,(H,17,18,19)/t9-/m1/s1 |
| InChIKey | VVWDXGZKPFERIJ-SECBINFHSA-N |
| XLogP | 4.63 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |