C18H22N6O3 — CID 75131120
5-[1-(1H-imidazol-2-ylmethyl)pyrrolidin-2-yl]-3-[2-(2-methoxyethoxy)-3-pyridinyl]-1,2,4-oxadiazole (PubChem CID 75131120) has the molecular formula C18H22N6O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 5-[1-(1H-imidazol-2-ylmethyl)pyrrolidin-2-yl]-3-[2-(2-methoxyethoxy)-3-pyridinyl]-1,2,4-oxadiazole.
| Compound Name | 5-[1-(1H-imidazol-2-ylmethyl)pyrrolidin-2-yl]-3-[2-(2-methoxyethoxy)-3-pyridinyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 75131120 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 5-[1-(1H-imidazol-2-ylmethyl)pyrrolidin-2-yl]-3-[2-(2-methoxyethoxy)-3-pyridinyl]-1,2,4-oxadiazole |
| SMILES | COCCOc1ncccc1-c1noc(C2CCCN2Cc2ncc[nH]2)n1 |
| InChI | InChI=1S/C18H22N6O3/c1-25-10-11-26-17-13(4-2-6-21-17)16-22-18(27-23-16)14-5-3-9-24(14)12-15-19-7-8-20-15/h2,4,6-8,14H,3,5,9-12H2,1H3,(H,19,20) |
| InChIKey | FUQSJYHDKRYKEM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|