C18H27N4O2+ — CID 7513687
4-ethyl-N-[(3S)-1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]piperazin-4-ium-1-carboxamide (PubChem CID 7513687) has the molecular formula C18H27N4O2+ and a molecular weight of 331.44 g/mol. Its IUPAC name is 4-ethyl-N-[(3S)-1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]piperazin-4-ium-1-carboxamide.
| Compound Name | 4-ethyl-N-[(3S)-1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]piperazin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 7513687 |
| Molecular Formula | C18H27N4O2+ |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 4-ethyl-N-[(3S)-1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]piperazin-4-ium-1-carboxamide |
| SMILES | CC[NH+]1CCN(C(=O)N[C@H]2CC(=O)N(c3ccc(C)cc3)C2)CC1 |
| InChI | InChI=1S/C18H26N4O2/c1-3-20-8-10-21(11-9-20)18(24)19-15-12-17(23)22(13-15)16-6-4-14(2)5-7-16/h4-7,15H,3,8-13H2,1-2H3,(H,19,24)/p+1/t15-/m0/s1 |
| InChIKey | MBXYDBQBOFJNFU-HNNXBMFYSA-O |
| XLogP | 0.03 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |