C19H26N4O4 — CID 7513689
ethyl 4-[[(3R)-1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]carbamoyl]piperazine-1-carboxylate (PubChem CID 7513689) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is ethyl 4-[[(3R)-1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]carbamoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[[(3R)-1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]carbamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 7513689 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | ethyl 4-[[(3R)-1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]carbamoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)N[C@@H]2CC(=O)N(c3ccc(C)cc3)C2)CC1 |
| InChI | InChI=1S/C19H26N4O4/c1-3-27-19(26)22-10-8-21(9-11-22)18(25)20-15-12-17(24)23(13-15)16-6-4-14(2)5-7-16/h4-7,15H,3,8-13H2,1-2H3,(H,20,25)/t15-/m1/s1 |
| InChIKey | SRFIEMJJNZPGMX-OAHLLOKOSA-N |
| XLogP | 1.58 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |