C10H16O4 — CID 75149686
6,7-dihydroxy-4,7-dimethyl-3,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-1-one (PubChem CID 75149686) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is 6,7-dihydroxy-4,7-dimethyl-3,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-1-one.
| Compound Name | 6,7-dihydroxy-4,7-dimethyl-3,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-1-one |
|---|---|
| PubChem CID | 75149686 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 6,7-dihydroxy-4,7-dimethyl-3,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-1-one |
| SMILES | CC1COC(=O)C2C1CC(O)C2(C)O |
| InChI | InChI=1S/C10H16O4/c1-5-4-14-9(12)8-6(5)3-7(11)10(8,2)13/h5-8,11,13H,3-4H2,1-2H3 |
| InChIKey | PEZCHMXCLXLNIE-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |