C25H32FN5O2 — CID 75158892
N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-7-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[g]indazole-3-carboxamide (PubChem CID 75158892) has the molecular formula C25H32FN5O2 and a molecular weight of 453.56 g/mol. Its IUPAC name is N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-7-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[g]indazole-3-carboxamide.
| Compound Name | N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-7-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 75158892 |
| Molecular Formula | C25H32FN5O2 |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-7-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[g]indazole-3-carboxamide |
| SMILES | COc1ccc2c(c1)CCC1C(C(=O)NCCN3CCN(c4ccccc4F)CC3)NNC21 |
| InChI | InChI=1S/C25H32FN5O2/c1-33-18-7-9-19-17(16-18)6-8-20-23(19)28-29-24(20)25(32)27-10-11-30-12-14-31(15-13-30)22-5-3-2-4-21(22)26/h2-5,7,9,16,20,23-24,28-29H,6,8,10-15H2,1H3,(H,27,32) |
| InChIKey | AJWCVTALIGASHT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |