C17H14FN3O5 — CID 75171636
5-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(furan-2-yl)imidazolidine-2,4-dione (PubChem CID 75171636) has the molecular formula C17H14FN3O5 and a molecular weight of 359.31 g/mol. Its IUPAC name is 5-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(furan-2-yl)imidazolidine-2,4-dione.
| Compound Name | 5-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(furan-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 75171636 |
| Molecular Formula | C17H14FN3O5 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 5-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(furan-2-yl)imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1F)C(=O)N(CC1(c3ccco3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C17H14FN3O5/c1-25-10-5-4-9-7-21(14(22)12(9)13(10)18)8-17(11-3-2-6-26-11)15(23)19-16(24)20-17/h2-6H,7-8H2,1H3,(H2,19,20,23,24) |
| InChIKey | BDROZTSMAKJUKB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|