C22H30N2O7 — CID 75179645
4-oxo-4-(4-prop-2-ynoxyphenyl)-N-[3-[3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]propyl]butanamide (PubChem CID 75179645) has the molecular formula C22H30N2O7 and a molecular weight of 434.49 g/mol. Its IUPAC name is 4-oxo-4-(4-prop-2-ynoxyphenyl)-N-[3-[3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]propyl]butanamide.
| Compound Name | 4-oxo-4-(4-prop-2-ynoxyphenyl)-N-[3-[3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]propyl]butanamide |
|---|---|
| PubChem CID | 75179645 |
| Molecular Formula | C22H30N2O7 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 4-oxo-4-(4-prop-2-ynoxyphenyl)-N-[3-[3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]propyl]butanamide |
| SMILES | C#CCOc1ccc(C(=O)CCC(=O)NCCCN2CC(O)C(O)C(O)C2CO)cc1 |
| InChI | InChI=1S/C22H30N2O7/c1-2-12-31-16-6-4-15(5-7-16)18(26)8-9-20(28)23-10-3-11-24-13-19(27)22(30)21(29)17(24)14-25/h1,4-7,17,19,21-22,25,27,29-30H,3,8-14H2,(H,23,28) |
| InChIKey | AAWCULUAQOJFJX-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|