C25H38N4O — CID 75180980
2-[2-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]-2,9-diazaspiro[5.5]undecan-1-one (PubChem CID 75180980) has the molecular formula C25H38N4O and a molecular weight of 410.61 g/mol. Its IUPAC name is 2-[2-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]-2,9-diazaspiro[5.5]undecan-1-one.
| Compound Name | 2-[2-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]-2,9-diazaspiro[5.5]undecan-1-one |
|---|---|
| PubChem CID | 75180980 |
| Molecular Formula | C25H38N4O |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | 2-[2-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]-2,9-diazaspiro[5.5]undecan-1-one |
| SMILES | Cc1cc(N2CCC(N3CCCC3C)C2)ccc1N1CCCC2(CCNCC2)C1=O |
| InChI | InChI=1S/C25H38N4O/c1-19-17-21(27-16-8-22(18-27)28-14-3-5-20(28)2)6-7-23(19)29-15-4-9-25(24(29)30)10-12-26-13-11-25/h6-7,17,20,22,26H,3-5,8-16,18H2,1-2H3 |
| InChIKey | FSKJHDYTJDGTJD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|