C29H44N2O2 — CID 91250016
2-[2-methyl-4-[3-(3-methylcyclooctyl)pyrrolidin-1-yl]phenyl]-9-oxa-2-azaspiro[5.5]undecan-1-one (PubChem CID 91250016) has the molecular formula C29H44N2O2 and a molecular weight of 452.68 g/mol. Its IUPAC name is 2-[2-methyl-4-[3-(3-methylcyclooctyl)pyrrolidin-1-yl]phenyl]-9-oxa-2-azaspiro[5.5]undecan-1-one.
| Compound Name | 2-[2-methyl-4-[3-(3-methylcyclooctyl)pyrrolidin-1-yl]phenyl]-9-oxa-2-azaspiro[5.5]undecan-1-one |
|---|---|
| PubChem CID | 91250016 |
| Molecular Formula | C29H44N2O2 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.34 |
| IUPAC Name | 2-[2-methyl-4-[3-(3-methylcyclooctyl)pyrrolidin-1-yl]phenyl]-9-oxa-2-azaspiro[5.5]undecan-1-one |
| SMILES | Cc1cc(N2CCC(C3CCCCCC(C)C3)C2)ccc1N1CCCC2(CCOCC2)C1=O |
| InChI | InChI=1S/C29H44N2O2/c1-22-7-4-3-5-8-24(19-22)25-11-16-30(21-25)26-9-10-27(23(2)20-26)31-15-6-12-29(28(31)32)13-17-33-18-14-29/h9-10,20,22,24-25H,3-8,11-19,21H2,1-2H3 |
| InChIKey | AYMSHRQLJHWCHR-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|