C23H28N2O4S — CID 75203254
N-[[(1R,3S)-3-(ethylcarbamoyl)cyclopentyl]methyl]-4-(2-methylsulfonylphenyl)benzamide (PubChem CID 75203254) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is N-[[(1R,3S)-3-(ethylcarbamoyl)cyclopentyl]methyl]-4-(2-methylsulfonylphenyl)benzamide.
| Compound Name | N-[[(1R,3S)-3-(ethylcarbamoyl)cyclopentyl]methyl]-4-(2-methylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 75203254 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-[[(1R,3S)-3-(ethylcarbamoyl)cyclopentyl]methyl]-4-(2-methylsulfonylphenyl)benzamide |
| SMILES | CCNC(=O)[C@H]1CC[C@@H](CNC(=O)c2ccc(-c3ccccc3S(C)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C23H28N2O4S/c1-3-24-23(27)19-9-8-16(14-19)15-25-22(26)18-12-10-17(11-13-18)20-6-4-5-7-21(20)30(2,28)29/h4-7,10-13,16,19H,3,8-9,14-15H2,1-2H3,(H,24,27)(H,25,26)/t16-,19+/m1/s1 |
| InChIKey | ZAIKLPAMYIKTGU-APWZRJJASA-N |
| XLogP | 3.04 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |