C14H21N3O — CID 58874409
N-[[(3R,4S)-3,4-diaminocyclohexyl]methyl]benzamide (PubChem CID 58874409) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is N-[[(3R,4S)-3,4-diaminocyclohexyl]methyl]benzamide.
| Compound Name | N-[[(3R,4S)-3,4-diaminocyclohexyl]methyl]benzamide |
|---|---|
| PubChem CID | 58874409 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | N-[[(3R,4S)-3,4-diaminocyclohexyl]methyl]benzamide |
| SMILES | N[C@@H]1CC(CNC(=O)c2ccccc2)CC[C@@H]1N |
| InChI | InChI=1S/C14H21N3O/c15-12-7-6-10(8-13(12)16)9-17-14(18)11-4-2-1-3-5-11/h1-5,10,12-13H,6-9,15-16H2,(H,17,18)/t10?,12-,13+/m0/s1 |
| InChIKey | XYDJZSZHWUCNNI-HEVMSJOKSA-N |
| XLogP | 0.87 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |