C18H18N2O2S3 — CID 51064847
N-[[5-(benzamidomethyl)-1,2,4-trithiolan-3-yl]methyl]benzamide (PubChem CID 51064847) has the molecular formula C18H18N2O2S3 and a molecular weight of 390.56 g/mol. Its IUPAC name is N-[[5-(benzamidomethyl)-1,2,4-trithiolan-3-yl]methyl]benzamide.
| Compound Name | N-[[5-(benzamidomethyl)-1,2,4-trithiolan-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 51064847 |
| Molecular Formula | C18H18N2O2S3 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | N-[[5-(benzamidomethyl)-1,2,4-trithiolan-3-yl]methyl]benzamide |
| SMILES | O=C(NCC1SSC(CNC(=O)c2ccccc2)S1)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O2S3/c21-17(13-7-3-1-4-8-13)19-11-15-23-16(25-24-15)12-20-18(22)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2,(H,19,21)(H,20,22) |
| InChIKey | MBYBEJZIXXFIIV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|