C14H19N3O9 — CID 75203746
(4S)-4-[(2-aminoacetyl)amino]-5-[(3R)-1-[(1S)-1-carboxy-2-hydroxyethyl]-2,5-dioxopyrrolidin-3-yl]-5-oxopentanoic acid (PubChem CID 75203746) has the molecular formula C14H19N3O9 and a molecular weight of 373.32 g/mol. Its IUPAC name is (4S)-4-[(2-aminoacetyl)amino]-5-[(3R)-1-[(1S)-1-carboxy-2-hydroxyethyl]-2,5-dioxopyrrolidin-3-yl]-5-oxopentanoic acid.
| Compound Name | (4S)-4-[(2-aminoacetyl)amino]-5-[(3R)-1-[(1S)-1-carboxy-2-hydroxyethyl]-2,5-dioxopyrrolidin-3-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 75203746 |
| Molecular Formula | C14H19N3O9 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (4S)-4-[(2-aminoacetyl)amino]-5-[(3R)-1-[(1S)-1-carboxy-2-hydroxyethyl]-2,5-dioxopyrrolidin-3-yl]-5-oxopentanoic acid |
| SMILES | NCC(=O)N[C@@H](CCC(=O)O)C(=O)[C@H]1CC(=O)N([C@@H](CO)C(=O)O)C1=O |
| InChI | InChI=1S/C14H19N3O9/c15-4-9(19)16-7(1-2-11(21)22)12(23)6-3-10(20)17(13(6)24)8(5-18)14(25)26/h6-8,18H,1-5,15H2,(H,16,19)(H,21,22)(H,25,26)/t6-,7+,8+/m1/s1 |
| InChIKey | FHRZMEGOJFNOSC-CSMHCCOUSA-N |
| XLogP | -3.32 |
| TPSA | 204.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|