C17H26N4O8 — CID 75204116
(2S)-6-amino-2-[(3R)-3-[(2S)-2-[(2-aminoacetyl)amino]-4-carboxybutanoyl]-2,5-dioxopyrrolidin-1-yl]hexanoic acid (PubChem CID 75204116) has the molecular formula C17H26N4O8 and a molecular weight of 414.42 g/mol. Its IUPAC name is (2S)-6-amino-2-[(3R)-3-[(2S)-2-[(2-aminoacetyl)amino]-4-carboxybutanoyl]-2,5-dioxopyrrolidin-1-yl]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[(3R)-3-[(2S)-2-[(2-aminoacetyl)amino]-4-carboxybutanoyl]-2,5-dioxopyrrolidin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 75204116 |
| Molecular Formula | C17H26N4O8 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (2S)-6-amino-2-[(3R)-3-[(2S)-2-[(2-aminoacetyl)amino]-4-carboxybutanoyl]-2,5-dioxopyrrolidin-1-yl]hexanoic acid |
| SMILES | NCCCC[C@@H](C(=O)O)N1C(=O)C[C@H](C(=O)[C@H](CCC(=O)O)NC(=O)CN)C1=O |
| InChI | InChI=1S/C17H26N4O8/c18-6-2-1-3-11(17(28)29)21-13(23)7-9(16(21)27)15(26)10(4-5-14(24)25)20-12(22)8-19/h9-11H,1-8,18-19H2,(H,20,22)(H,24,25)(H,28,29)/t9-,10+,11+/m1/s1 |
| InChIKey | ZWUUHJXWDMBINR-VWYCJHECSA-N |
| XLogP | -2.18 |
| TPSA | 210.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|