2-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)octanedioic acid

C12H17NO7 — CID 67701766

IUPAC2-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)octanedioic acid
SMILESO=C(O)CCCCCC(C(=O)O)N1C(=O)CC(O)C1=O
InChIInChI=1S/C12H17NO7/c14-8-6-9(15)13(11(8)18)7(12(19)20)4-2-1-3-5-10(16)17/h7-8,14H,1-6H2,(H,16,17)(H,19,20)
InChIKeyIGLUQCZMSMBVID-UHFFFAOYSA-N
MW287.27 g/mol
LogP-0.41
Rot. Bonds8

About 2-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)octanedioic acid

2-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)octanedioic acid (PubChem CID 67701766) has the molecular formula C12H17NO7 and a molecular weight of 287.27 g/mol. Its IUPAC name is 2-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)octanedioic acid.

Molecular Properties

Compound Name2-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)octanedioic acid
PubChem CID67701766
Molecular FormulaC12H17NO7
Molecular Weight287.27 g/mol
Exact Mass287.10
IUPAC Name2-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)octanedioic acid
SMILESO=C(O)CCCCCC(C(=O)O)N1C(=O)CC(O)C1=O
InChIInChI=1S/C12H17NO7/c14-8-6-9(15)13(11(8)18)7(12(19)20)4-2-1-3-5-10(16)17/h7-8,14H,1-6H2,(H,16,17)(H,19,20)
InChIKeyIGLUQCZMSMBVID-UHFFFAOYSA-N
XLogP-0.41
TPSA132.21 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.27
LogP ≤ 5-0.41
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 2-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)octanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)octanedioic acid?
The IUPAC name of 2-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)octanedioic acid (CID 67701766) is 2-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)octanedioic acid.
What is the SMILES notation for 2-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)octanedioic acid?
The canonical SMILES for 2-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)octanedioic acid is O=C(O)CCCCCC(C(=O)O)N1C(=O)CC(O)C1=O.
What is the InChIKey of 2-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)octanedioic acid?
The InChIKey is IGLUQCZMSMBVID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO7/c14-8-6-9(15)13(11(8)18)7(12(19)20)4-2-1-3-5-10(16)17/h7-8,14H,1-6H2,(H,16,17)(H,19,20).
What are the key properties of 2-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)octanedioic acid?
2-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)octanedioic acid has a molecular weight of 287.27 g/mol, XLogP of -0.41, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)octanedioic acid is sourced from PubChem (CID 67701766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).