C22H26N5O2S+ — CID 7520797
3-methyl-N-[4-[6-(4-methylpiperazin-4-ium-1-yl)pyridazin-3-yl]phenyl]benzenesulfonamide (PubChem CID 7520797) has the molecular formula C22H26N5O2S+ and a molecular weight of 424.55 g/mol. Its IUPAC name is 3-methyl-N-[4-[6-(4-methylpiperazin-4-ium-1-yl)pyridazin-3-yl]phenyl]benzenesulfonamide.
| Compound Name | 3-methyl-N-[4-[6-(4-methylpiperazin-4-ium-1-yl)pyridazin-3-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 7520797 |
| Molecular Formula | C22H26N5O2S+ |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 3-methyl-N-[4-[6-(4-methylpiperazin-4-ium-1-yl)pyridazin-3-yl]phenyl]benzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)Nc2ccc(-c3ccc(N4CC[NH+](C)CC4)nn3)cc2)c1 |
| InChI | InChI=1S/C22H25N5O2S/c1-17-4-3-5-20(16-17)30(28,29)25-19-8-6-18(7-9-19)21-10-11-22(24-23-21)27-14-12-26(2)13-15-27/h3-11,16,25H,12-15H2,1-2H3/p+1 |
| InChIKey | QHXPOOMZOZNAQD-UHFFFAOYSA-O |
| XLogP | 1.59 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |