C16H16ClN3O3 — CID 75212169
4-chloro-2-N-(furan-2-ylmethylideneamino)-1-N-propan-2-ylbenzene-1,2-dicarboxamide (PubChem CID 75212169) has the molecular formula C16H16ClN3O3 and a molecular weight of 333.78 g/mol. Its IUPAC name is 4-chloro-2-N-(furan-2-ylmethylideneamino)-1-N-propan-2-ylbenzene-1,2-dicarboxamide.
| Compound Name | 4-chloro-2-N-(furan-2-ylmethylideneamino)-1-N-propan-2-ylbenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 75212169 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 4-chloro-2-N-(furan-2-ylmethylideneamino)-1-N-propan-2-ylbenzene-1,2-dicarboxamide |
| SMILES | CC(C)NC(=O)c1ccc(Cl)cc1C(=O)NN=Cc1ccco1 |
| InChI | InChI=1S/C16H16ClN3O3/c1-10(2)19-15(21)13-6-5-11(17)8-14(13)16(22)20-18-9-12-4-3-7-23-12/h3-10H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | QCYIMTIBTDAEOA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|