C32H40O14 — CID 75215096
[8-[acetyloxy(furan-3-yl)methyl]-5-ethyl-1,9,10,11,20-pentahydroxy-8,18-dimethyl-15-oxo-4,14,22-trioxaheptacyclo[16.2.1.12,5.03,7.03,11.012,17.012,20]docosan-21-yl] acetate (PubChem CID 75215096) has the molecular formula C32H40O14 and a molecular weight of 648.66 g/mol. Its IUPAC name is [8-[acetyloxy(furan-3-yl)methyl]-5-ethyl-1,9,10,11,20-pentahydroxy-8,18-dimethyl-15-oxo-4,14,22-trioxaheptacyclo[16.2.1.12,5.03,7.03,11.012,17.012,20]docosan-21-yl] acetate.
| Compound Name | [8-[acetyloxy(furan-3-yl)methyl]-5-ethyl-1,9,10,11,20-pentahydroxy-8,18-dimethyl-15-oxo-4,14,22-trioxaheptacyclo[16.2.1.12,5.03,7.03,11.012,17.012,20]docosan-21-yl] acetate |
|---|---|
| PubChem CID | 75215096 |
| Molecular Formula | C32H40O14 |
| Molecular Weight | 648.66 g/mol |
| Exact Mass | 648.24 |
| IUPAC Name | [8-[acetyloxy(furan-3-yl)methyl]-5-ethyl-1,9,10,11,20-pentahydroxy-8,18-dimethyl-15-oxo-4,14,22-trioxaheptacyclo[16.2.1.12,5.03,7.03,11.012,17.012,20]docosan-21-yl] acetate |
| SMILES | CCC12CC3C(C)(C(OC(C)=O)c4ccoc4)C(O)C(O)C4(O)C3(O1)C(O2)C1(O)C(OC(C)=O)C2(C)CC1(O)C41COC(=O)CC21 |
| InChI | InChI=1S/C32H40O14/c1-6-27-10-18-26(5,22(43-14(2)33)16-7-8-41-11-16)20(36)21(37)32(40)28-13-42-19(35)9-17(28)25(4)12-29(28,38)30(39,23(25)44-15(3)34)24(45-27)31(18,32)46-27/h7-8,11,17-18,20-24,36-40H,6,9-10,12-13H2,1-5H3 |
| InChIKey | JEIJTJHVAJQJIO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 211.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.66 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|