C30H34O14 — CID 75604842
[20-(furan-3-yl)-2,3,4,17-tetrahydroxy-5,14,19-trimethyl-8,22-dioxo-9,13,15,21,25-pentaoxaoctacyclo[12.10.1.15,12.01,16.03,12.06,11.011,16.019,24]hexacosan-18-yl] acetate (PubChem CID 75604842) has the molecular formula C30H34O14 and a molecular weight of 618.59 g/mol. Its IUPAC name is [20-(furan-3-yl)-2,3,4,17-tetrahydroxy-5,14,19-trimethyl-8,22-dioxo-9,13,15,21,25-pentaoxaoctacyclo[12.10.1.15,12.01,16.03,12.06,11.011,16.019,24]hexacosan-18-yl] acetate.
| Compound Name | [20-(furan-3-yl)-2,3,4,17-tetrahydroxy-5,14,19-trimethyl-8,22-dioxo-9,13,15,21,25-pentaoxaoctacyclo[12.10.1.15,12.01,16.03,12.06,11.011,16.019,24]hexacosan-18-yl] acetate |
|---|---|
| PubChem CID | 75604842 |
| Molecular Formula | C30H34O14 |
| Molecular Weight | 618.59 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | [20-(furan-3-yl)-2,3,4,17-tetrahydroxy-5,14,19-trimethyl-8,22-dioxo-9,13,15,21,25-pentaoxaoctacyclo[12.10.1.15,12.01,16.03,12.06,11.011,16.019,24]hexacosan-18-yl] acetate |
| SMILES | CC(=O)OC1C(O)C23OC4(C)OC2(C2CC(=O)OC(c5ccoc5)C12C)C(O)C1(O)C(O)C2(C)CC1(O4)C31COC(=O)CC21 |
| InChI | InChI=1S/C30H34O14/c1-12(31)40-20-18(34)30-26-11-39-16(32)7-14(26)23(2)10-27(26)28(37,21(23)35)22(36)29(30,43-25(4,42-27)44-30)15-8-17(33)41-19(24(15,20)3)13-5-6-38-9-13/h5-6,9,14-15,18-22,34-37H,7-8,10-11H2,1-4H3 |
| InChIKey | UDYRKFWKABPBEK-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 200.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.59 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|