C12H18O2 — CID 75219741
7'a-methylspiro[1,3-dioxolane-2,7'-2,4,5,6-tetrahydro-1H-indene] (PubChem CID 75219741) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 7'a-methylspiro[1,3-dioxolane-2,7'-2,4,5,6-tetrahydro-1H-indene].
| Compound Name | 7'a-methylspiro[1,3-dioxolane-2,7'-2,4,5,6-tetrahydro-1H-indene] |
|---|---|
| PubChem CID | 75219741 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 7'a-methylspiro[1,3-dioxolane-2,7'-2,4,5,6-tetrahydro-1H-indene] |
| SMILES | CC12CCC=C1CCCC21OCCO1 |
| InChI | InChI=1S/C12H18O2/c1-11-6-2-4-10(11)5-3-7-12(11)13-8-9-14-12/h4H,2-3,5-9H2,1H3 |
| InChIKey | OTACCZYAJOFTHU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|