C13H20O2 — CID 25058445
8a-methylspiro[1,2,4,5,7,8-hexahydroazulene-6,2'-1,3-dioxolane] (PubChem CID 25058445) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 8a-methylspiro[1,2,4,5,7,8-hexahydroazulene-6,2'-1,3-dioxolane].
| Compound Name | 8a-methylspiro[1,2,4,5,7,8-hexahydroazulene-6,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 25058445 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 8a-methylspiro[1,2,4,5,7,8-hexahydroazulene-6,2'-1,3-dioxolane] |
| SMILES | CC12CCC=C1CCC1(CC2)OCCO1 |
| InChI | InChI=1S/C13H20O2/c1-12-5-2-3-11(12)4-6-13(8-7-12)14-9-10-15-13/h3H,2,4-10H2,1H3 |
| InChIKey | QULYAUHQMIAGMU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|