C31H39N9O8 — CID 75244772
2-(cyclopropylmethyl)-5-(furan-2-ylmethyl)-3,6,9,15,18-pentaoxo-8-[3-(pyrazine-2-carbonylamino)propyl]-1,4,7,10,14-pentazacyclooctadec-16-ene-13-carboxamide (PubChem CID 75244772) has the molecular formula C31H39N9O8 and a molecular weight of 665.71 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-5-(furan-2-ylmethyl)-3,6,9,15,18-pentaoxo-8-[3-(pyrazine-2-carbonylamino)propyl]-1,4,7,10,14-pentazacyclooctadec-16-ene-13-carboxamide.
| Compound Name | 2-(cyclopropylmethyl)-5-(furan-2-ylmethyl)-3,6,9,15,18-pentaoxo-8-[3-(pyrazine-2-carbonylamino)propyl]-1,4,7,10,14-pentazacyclooctadec-16-ene-13-carboxamide |
|---|---|
| PubChem CID | 75244772 |
| Molecular Formula | C31H39N9O8 |
| Molecular Weight | 665.71 g/mol |
| Exact Mass | 665.29 |
| IUPAC Name | 2-(cyclopropylmethyl)-5-(furan-2-ylmethyl)-3,6,9,15,18-pentaoxo-8-[3-(pyrazine-2-carbonylamino)propyl]-1,4,7,10,14-pentazacyclooctadec-16-ene-13-carboxamide |
| SMILES | NC(=O)C1CCNC(=O)C(CCCNC(=O)c2cnccn2)NC(=O)C(Cc2ccco2)NC(=O)C(CC2CC2)NC(=O)C=CC(=O)N1 |
| InChI | InChI=1S/C31H39N9O8/c32-27(43)20-9-11-36-28(44)21(4-1-10-35-29(45)24-17-33-12-13-34-24)39-31(47)23(16-19-3-2-14-48-19)40-30(46)22(15-18-5-6-18)38-26(42)8-7-25(41)37-20/h2-3,7-8,12-14,17-18,20-23H,1,4-6,9-11,15-16H2,(H2,32,43)(H,35,45)(H,36,44)(H,37,41)(H,38,42)(H,39,47)(H,40,46) |
| InChIKey | ISTHYUAXOLPQGF-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 256.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.71 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|