C17H14Cl2F3N3O — CID 75254921
5-(3-chlorophenyl)-N-[4-chloro-2-(trifluoromethyl)phenyl]pyrazolidine-3-carboxamide (PubChem CID 75254921) has the molecular formula C17H14Cl2F3N3O and a molecular weight of 404.22 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-[4-chloro-2-(trifluoromethyl)phenyl]pyrazolidine-3-carboxamide.
| Compound Name | 5-(3-chlorophenyl)-N-[4-chloro-2-(trifluoromethyl)phenyl]pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 75254921 |
| Molecular Formula | C17H14Cl2F3N3O |
| Molecular Weight | 404.22 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 5-(3-chlorophenyl)-N-[4-chloro-2-(trifluoromethyl)phenyl]pyrazolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(F)(F)F)C1CC(c2cccc(Cl)c2)NN1 |
| InChI | InChI=1S/C17H14Cl2F3N3O/c18-10-3-1-2-9(6-10)14-8-15(25-24-14)16(26)23-13-5-4-11(19)7-12(13)17(20,21)22/h1-7,14-15,24-25H,8H2,(H,23,26) |
| InChIKey | NRBGTEMMOQTSND-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.22 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |