C13H12ClF3N2O2 — CID 110682207
N-[4-chloro-2-(trifluoromethyl)phenyl]-2-oxopiperidine-4-carboxamide (PubChem CID 110682207) has the molecular formula C13H12ClF3N2O2 and a molecular weight of 320.70 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2-oxopiperidine-4-carboxamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-oxopiperidine-4-carboxamide |
|---|---|
| PubChem CID | 110682207 |
| Molecular Formula | C13H12ClF3N2O2 |
| Molecular Weight | 320.70 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-oxopiperidine-4-carboxamide |
| SMILES | O=C1CC(C(=O)Nc2ccc(Cl)cc2C(F)(F)F)CCN1 |
| InChI | InChI=1S/C13H12ClF3N2O2/c14-8-1-2-10(9(6-8)13(15,16)17)19-12(21)7-3-4-18-11(20)5-7/h1-2,6-7H,3-5H2,(H,18,20)(H,19,21) |
| InChIKey | LICZDNGQSIRAHR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.70 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |