C12H10ClF3N2O3 — CID 110696868
N-[4-chloro-2-(trifluoromethyl)phenyl]-5-oxomorpholine-3-carboxamide (PubChem CID 110696868) has the molecular formula C12H10ClF3N2O3 and a molecular weight of 322.67 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-5-oxomorpholine-3-carboxamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-5-oxomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 110696868 |
| Molecular Formula | C12H10ClF3N2O3 |
| Molecular Weight | 322.67 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-5-oxomorpholine-3-carboxamide |
| SMILES | O=C1COCC(C(=O)Nc2ccc(Cl)cc2C(F)(F)F)N1 |
| InChI | InChI=1S/C12H10ClF3N2O3/c13-6-1-2-8(7(3-6)12(14,15)16)18-11(20)9-4-21-5-10(19)17-9/h1-3,9H,4-5H2,(H,17,19)(H,18,20) |
| InChIKey | YKSNMMFDUPUORD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.67 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |