C23H21FN3O3S+ — CID 75255647
N-(3-ethylphenyl)-2-[3-[(2-fluorophenyl)methyl]-2,4-dioxo-4aH-thieno[3,2-d]pyrimidin-1-ium-1-yl]acetamide (PubChem CID 75255647) has the molecular formula C23H21FN3O3S+ and a molecular weight of 438.50 g/mol. Its IUPAC name is N-(3-ethylphenyl)-2-[3-[(2-fluorophenyl)methyl]-2,4-dioxo-4aH-thieno[3,2-d]pyrimidin-1-ium-1-yl]acetamide.
| Compound Name | N-(3-ethylphenyl)-2-[3-[(2-fluorophenyl)methyl]-2,4-dioxo-4aH-thieno[3,2-d]pyrimidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 75255647 |
| Molecular Formula | C23H21FN3O3S+ |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N-(3-ethylphenyl)-2-[3-[(2-fluorophenyl)methyl]-2,4-dioxo-4aH-thieno[3,2-d]pyrimidin-1-ium-1-yl]acetamide |
| SMILES | CCc1cccc(NC(=O)C[N+]2=C3C=CSC3C(=O)N(Cc3ccccc3F)C2=O)c1 |
| InChI | InChI=1S/C23H20FN3O3S/c1-2-15-6-5-8-17(12-15)25-20(28)14-26-19-10-11-31-21(19)22(29)27(23(26)30)13-16-7-3-4-9-18(16)24/h3-12,21H,2,13-14H2,1H3/p+1 |
| InChIKey | DAKVYIQABANPPI-UHFFFAOYSA-O |
| XLogP | 3.57 |
| TPSA | 69.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|