C15H24FN3O — CID 75257296
N-[[3-(4-fluorophenyl)pyrazolidin-4-yl]methyl]-2-propoxyethanamine (PubChem CID 75257296) has the molecular formula C15H24FN3O and a molecular weight of 281.38 g/mol. Its IUPAC name is N-[[3-(4-fluorophenyl)pyrazolidin-4-yl]methyl]-2-propoxyethanamine.
| Compound Name | N-[[3-(4-fluorophenyl)pyrazolidin-4-yl]methyl]-2-propoxyethanamine |
|---|---|
| PubChem CID | 75257296 |
| Molecular Formula | C15H24FN3O |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | N-[[3-(4-fluorophenyl)pyrazolidin-4-yl]methyl]-2-propoxyethanamine |
| SMILES | CCCOCCNCC1CNNC1c1ccc(F)cc1 |
| InChI | InChI=1S/C15H24FN3O/c1-2-8-20-9-7-17-10-13-11-18-19-15(13)12-3-5-14(16)6-4-12/h3-6,13,15,17-19H,2,7-11H2,1H3 |
| InChIKey | OWFUGRGGGYXPLT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|