C18H20ClF2N3O — CID 52990447
1-[3-(4-chlorophenyl)pyrazolidin-4-yl]-N-[[2-(difluoromethoxy)phenyl]methyl]methanamine (PubChem CID 52990447) has the molecular formula C18H20ClF2N3O and a molecular weight of 367.83 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)pyrazolidin-4-yl]-N-[[2-(difluoromethoxy)phenyl]methyl]methanamine.
| Compound Name | 1-[3-(4-chlorophenyl)pyrazolidin-4-yl]-N-[[2-(difluoromethoxy)phenyl]methyl]methanamine |
|---|---|
| PubChem CID | 52990447 |
| Molecular Formula | C18H20ClF2N3O |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 1-[3-(4-chlorophenyl)pyrazolidin-4-yl]-N-[[2-(difluoromethoxy)phenyl]methyl]methanamine |
| SMILES | FC(F)Oc1ccccc1CNCC1CNNC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClF2N3O/c19-15-7-5-12(6-8-15)17-14(11-23-24-17)10-22-9-13-3-1-2-4-16(13)25-18(20)21/h1-8,14,17-18,22-24H,9-11H2 |
| InChIKey | LRAFLTGBAZKYOY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |