C16H19ClN4 — CID 78305057
1-[3-(4-chlorophenyl)pyrazolidin-4-yl]-N-(pyridin-3-ylmethyl)methanamine (PubChem CID 78305057) has the molecular formula C16H19ClN4 and a molecular weight of 302.81 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)pyrazolidin-4-yl]-N-(pyridin-3-ylmethyl)methanamine.
| Compound Name | 1-[3-(4-chlorophenyl)pyrazolidin-4-yl]-N-(pyridin-3-ylmethyl)methanamine |
|---|---|
| PubChem CID | 78305057 |
| Molecular Formula | C16H19ClN4 |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1-[3-(4-chlorophenyl)pyrazolidin-4-yl]-N-(pyridin-3-ylmethyl)methanamine |
| SMILES | Clc1ccc(C2NNCC2CNCc2cccnc2)cc1 |
| InChI | InChI=1S/C16H19ClN4/c17-15-5-3-13(4-6-15)16-14(11-20-21-16)10-19-9-12-2-1-7-18-8-12/h1-8,14,16,19-21H,9-11H2 |
| InChIKey | PUNPFTFBVMGTMU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 48.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |